C34H32F6N4O3S — CID 87580305
tert-butyl 3-[[2-[3,5-bis(trifluoromethyl)benzoyl]-7-(1,3-thiazol-2-yl)-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate (PubChem CID 87580305) has the molecular formula C34H32F6N4O3S and a molecular weight of 690.71 g/mol. Its IUPAC name is tert-butyl 3-[[2-[3,5-bis(trifluoromethyl)benzoyl]-7-(1,3-thiazol-2-yl)-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-[3,5-bis(trifluoromethyl)benzoyl]-7-(1,3-thiazol-2-yl)-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 87580305 |
| Molecular Formula | C34H32F6N4O3S |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | tert-butyl 3-[[2-[3,5-bis(trifluoromethyl)benzoyl]-7-(1,3-thiazol-2-yl)-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CC2CN3CC(c4nccs4)=CCC3CN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C34H32F6N4O3S/c1-32(2,3)47-31(46)44-17-22(27-6-4-5-7-28(27)44)14-26-18-42-16-20(29-41-10-11-48-29)8-9-25(42)19-43(26)30(45)21-12-23(33(35,36)37)15-24(13-21)34(38,39)40/h4-8,10-13,15,17,25-26H,9,14,16,18-19H2,1-3H3 |
| InChIKey | MNEICDOHVAQQPR-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |