About 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione
2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione (PubChem CID 87580567) has the molecular formula C14H12O8
and a molecular weight of 308.24 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione |
| PubChem CID | 87580567 |
| Molecular Formula | C14H12O8 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione |
| SMILES | O=C1C=CC(=O)O1.O=C1OC(=O)c2ccccc21.OCCO |
| InChI | InChI=1S/C8H4O3.C4H2O3.C2H6O2/c9-7-5-3-1-2-4-6(5)8(10)11-7;5-3-1-2-4(6)7-3;3-1-2-4/h1-4H;1-2H;3-4H,1-2H2 |
| InChIKey | GWTLCDVWKFPCSO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione?
The IUPAC name of 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione (CID 87580567) is 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione.
What is the SMILES notation for 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione?
The canonical SMILES for 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione is O=C1C=CC(=O)O1.O=C1OC(=O)c2ccccc21.OCCO.
What is the InChIKey of 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione?
The InChIKey is GWTLCDVWKFPCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C4H2O3.C2H6O2/c9-7-5-3-1-2-4-6(5)8(10)11-7;5-3-1-2-4(6)7-3;3-1-2-4/h1-4H;1-2H;3-4H,1-2H2.
What are the key properties of 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione?
2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione has a molecular weight of 308.24 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;ethane-1,2-diol;furan-2,5-dione is sourced from PubChem (CID 87580567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).