About S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate
S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate (PubChem CID 87580725) has the molecular formula C16H12FNO3S
and a molecular weight of 317.34 g/mol. Its IUPAC name is S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate.
Molecular Properties
| Compound Name | S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate |
| PubChem CID | 87580725 |
| Molecular Formula | C16H12FNO3S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate |
| SMILES | O=C(C=Cc1ccc(F)c([N+](=O)[O-])c1)SCc1ccccc1 |
| InChI | InChI=1S/C16H12FNO3S/c17-14-8-6-12(10-15(14)18(20)21)7-9-16(19)22-11-13-4-2-1-3-5-13/h1-10H,11H2 |
| InChIKey | CHGQYJCKOFMFER-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate?
The IUPAC name of S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate (CID 87580725) is S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate.
What is the SMILES notation for S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate?
The canonical SMILES for S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate is O=C(C=Cc1ccc(F)c([N+](=O)[O-])c1)SCc1ccccc1.
What is the InChIKey of S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate?
The InChIKey is CHGQYJCKOFMFER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO3S/c17-14-8-6-12(10-15(14)18(20)21)7-9-16(19)22-11-13-4-2-1-3-5-13/h1-10H,11H2.
What are the key properties of S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate?
S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate has a molecular weight of 317.34 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl 3-(4-fluoro-3-nitrophenyl)prop-2-enethioate is sourced from PubChem (CID 87580725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).