(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid

C5H5ClN2O2S — CID 87580913

IUPAC(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid
SMILESCc1nc(NC(=O)O)sc1Cl
InChIInChI=1S/C5H5ClN2O2S/c1-2-3(6)11-4(7-2)8-5(9)10/h1H3,(H,7,8)(H,9,10)
InChIKeyBJYUMLDNFDYIHX-UHFFFAOYSA-N
MW192.63 g/mol
LogP2.19
Rot. Bonds1

About (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid

(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid (PubChem CID 87580913) has the molecular formula C5H5ClN2O2S and a molecular weight of 192.63 g/mol. Its IUPAC name is (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid.

Molecular Properties

Compound Name(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid
PubChem CID87580913
Molecular FormulaC5H5ClN2O2S
Molecular Weight192.63 g/mol
Exact Mass191.98
IUPAC Name(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid
SMILESCc1nc(NC(=O)O)sc1Cl
InChIInChI=1S/C5H5ClN2O2S/c1-2-3(6)11-4(7-2)8-5(9)10/h1H3,(H,7,8)(H,9,10)
InChIKeyBJYUMLDNFDYIHX-UHFFFAOYSA-N
XLogP2.19
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.63
LogP ≤ 52.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The IUPAC name of (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid (CID 87580913) is (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid.
What is the SMILES notation for (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The canonical SMILES for (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid is Cc1nc(NC(=O)O)sc1Cl.
What is the InChIKey of (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The InChIKey is BJYUMLDNFDYIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O2S/c1-2-3(6)11-4(7-2)8-5(9)10/h1H3,(H,7,8)(H,9,10).
What are the key properties of (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid?
(5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid has a molecular weight of 192.63 g/mol, XLogP of 2.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-4-methyl-1,3-thiazol-2-yl)carbamic acid is sourced from PubChem (CID 87580913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).