C33H14F12N2O10S2 — CID 87581119
[5-[2-[1,3-dioxo-2-[4-(trifluoromethyl)phenyl]sulfonyloxyisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 87581119) has the molecular formula C33H14F12N2O10S2 and a molecular weight of 890.59 g/mol. Its IUPAC name is [5-[2-[1,3-dioxo-2-[4-(trifluoromethyl)phenyl]sulfonyloxyisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[2-[1,3-dioxo-2-[4-(trifluoromethyl)phenyl]sulfonyloxyisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87581119 |
| Molecular Formula | C33H14F12N2O10S2 |
| Molecular Weight | 890.59 g/mol |
| Exact Mass | 889.99 |
| IUPAC Name | [5-[2-[1,3-dioxo-2-[4-(trifluoromethyl)phenyl]sulfonyloxyisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C1c2ccc(C(c3ccc4c(c3)C(=O)N(OS(=O)(=O)c3ccc(C(F)(F)F)cc3)C4=O)(C(F)(F)F)C(F)(F)F)cc2C(=O)N1OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H14F12N2O10S2/c34-30(35,36)15-1-7-19(8-2-15)58(52,53)56-46-25(48)21-11-5-17(13-23(21)27(46)50)29(32(40,41)42,33(43,44)45)18-6-12-22-24(14-18)28(51)47(26(22)49)57-59(54,55)20-9-3-16(4-10-20)31(37,38)39/h1-14H |
| InChIKey | CEWVQEXXKWVLPP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|