About 2-hydroxyacetic acid;methoxymethane
2-hydroxyacetic acid;methoxymethane (PubChem CID 87581490) has the molecular formula C4H10O4
and a molecular weight of 122.12 g/mol. Its IUPAC name is 2-hydroxyacetic acid;methoxymethane.
Molecular Properties
| Compound Name | 2-hydroxyacetic acid;methoxymethane |
| PubChem CID | 87581490 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2-hydroxyacetic acid;methoxymethane |
| SMILES | COC.O=C(O)CO |
| InChI | InChI=1S/C2H4O3.C2H6O/c3-1-2(4)5;1-3-2/h3H,1H2,(H,4,5);1-2H3 |
| InChIKey | NZTZVUDAROHQAO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyacetic acid;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetic acid;methoxymethane?
The IUPAC name of 2-hydroxyacetic acid;methoxymethane (CID 87581490) is 2-hydroxyacetic acid;methoxymethane.
What is the SMILES notation for 2-hydroxyacetic acid;methoxymethane?
The canonical SMILES for 2-hydroxyacetic acid;methoxymethane is COC.O=C(O)CO.
What is the InChIKey of 2-hydroxyacetic acid;methoxymethane?
The InChIKey is NZTZVUDAROHQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.C2H6O/c3-1-2(4)5;1-3-2/h3H,1H2,(H,4,5);1-2H3.
What are the key properties of 2-hydroxyacetic acid;methoxymethane?
2-hydroxyacetic acid;methoxymethane has a molecular weight of 122.12 g/mol, XLogP of -0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetic acid;methoxymethane is sourced from PubChem (CID 87581490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).