C16H15ClN2S — CID 87581526
(4R,5S)-5-(4-chlorophenyl)-4-methyl-4-phenylimidazolidine-2-thione (PubChem CID 87581526) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is (4R,5S)-5-(4-chlorophenyl)-4-methyl-4-phenylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-(4-chlorophenyl)-4-methyl-4-phenylimidazolidine-2-thione |
|---|---|
| PubChem CID | 87581526 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (4R,5S)-5-(4-chlorophenyl)-4-methyl-4-phenylimidazolidine-2-thione |
| SMILES | C[C@]1(c2ccccc2)NC(=S)N[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2S/c1-16(12-5-3-2-4-6-12)14(18-15(20)19-16)11-7-9-13(17)10-8-11/h2-10,14H,1H3,(H2,18,19,20)/t14-,16+/m0/s1 |
| InChIKey | WGQNDULYGXTANX-GOEBONIOSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|