C35H24F6N2O14S2 — CID 87581605
[5-[2-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate (PubChem CID 87581605) has the molecular formula C35H24F6N2O14S2 and a molecular weight of 874.70 g/mol. Its IUPAC name is [5-[2-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate.
| Compound Name | [5-[2-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 87581605 |
| Molecular Formula | C35H24F6N2O14S2 |
| Molecular Weight | 874.70 g/mol |
| Exact Mass | 874.06 |
| IUPAC Name | [5-[2-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(OS(=O)(=O)c4ccc(OC)c(OC)c4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1OC |
| InChI | InChI=1S/C35H24F6N2O14S2/c1-52-25-11-7-19(15-27(25)54-3)58(48,49)56-42-29(44)21-9-5-17(13-23(21)31(42)46)33(34(36,37)38,35(39,40)41)18-6-10-22-24(14-18)32(47)43(30(22)45)57-59(50,51)20-8-12-26(53-2)28(16-20)55-4/h5-16H,1-4H3 |
| InChIKey | WJPLVXTULFRKEI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 198.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|