About 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione
4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione (PubChem CID 87581664) has the molecular formula C33H26O5
and a molecular weight of 502.57 g/mol. Its IUPAC name is 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione.
Molecular Properties
| Compound Name | 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione |
| PubChem CID | 87581664 |
| Molecular Formula | C33H26O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione |
| SMILES | CCC(c1ccccc1)c1c(O)c2ccccc2oc1=O.O=C1c2ccccc2C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C18H16O3.C15H10O2/c1-2-13(12-8-4-3-5-9-12)16-17(19)14-10-6-7-11-15(14)21-18(16)20;16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h3-11,13,19H,2H2,1H3;1-9,13H |
| InChIKey | OMORWYSKBMYWPE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione?
The IUPAC name of 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione (CID 87581664) is 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione.
What is the SMILES notation for 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione?
The canonical SMILES for 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione is CCC(c1ccccc1)c1c(O)c2ccccc2oc1=O.O=C1c2ccccc2C(=O)C1c1ccccc1.
What is the InChIKey of 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione?
The InChIKey is OMORWYSKBMYWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O3.C15H10O2/c1-2-13(12-8-4-3-5-9-12)16-17(19)14-10-6-7-11-15(14)21-18(16)20;16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h3-11,13,19H,2H2,1H3;1-9,13H.
What are the key properties of 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione?
4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione has a molecular weight of 502.57 g/mol, XLogP of 6.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-(1-phenylpropyl)chromen-2-one;2-phenylindene-1,3-dione is sourced from PubChem (CID 87581664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).