C24H24N2O11S2 — CID 87581879
[5-(2-butylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] butane-1-sulfonate (PubChem CID 87581879) has the molecular formula C24H24N2O11S2 and a molecular weight of 580.59 g/mol. Its IUPAC name is [5-(2-butylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] butane-1-sulfonate.
| Compound Name | [5-(2-butylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] butane-1-sulfonate |
|---|---|
| PubChem CID | 87581879 |
| Molecular Formula | C24H24N2O11S2 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | [5-(2-butylsulfonyloxy-1,3-dioxoisoindol-5-yl)oxy-1,3-dioxoisoindol-2-yl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)ON1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(OS(=O)(=O)CCCC)C4=O)cc2C1=O |
| InChI | InChI=1S/C24H24N2O11S2/c1-3-5-11-38(31,32)36-25-21(27)17-9-7-15(13-19(17)23(25)29)35-16-8-10-18-20(14-16)24(30)26(22(18)28)37-39(33,34)12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | NXHQAWWDNNJJJL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 170.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|