About 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 8758218) has the molecular formula C16H23Cl2N3O3S
and a molecular weight of 408.35 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide |
| PubChem CID | 8758218 |
| Molecular Formula | C16H23Cl2N3O3S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H23Cl2N3O3S/c1-12(2)10-19-15(22)11-20-6-8-21(9-7-20)25(23,24)14-5-3-4-13(17)16(14)18/h3-5,12H,6-11H2,1-2H3,(H,19,22) |
| InChIKey | BGMDDHJQBVRJME-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide?
The IUPAC name of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide (CID 8758218) is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide.
What is the SMILES notation for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide?
The canonical SMILES for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide is CC(C)CNC(=O)CN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide?
The InChIKey is BGMDDHJQBVRJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2N3O3S/c1-12(2)10-19-15(22)11-20-6-8-21(9-7-20)25(23,24)14-5-3-4-13(17)16(14)18/h3-5,12H,6-11H2,1-2H3,(H,19,22).
What are the key properties of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide?
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide has a molecular weight of 408.35 g/mol, XLogP of 2.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-(2-methylpropyl)acetamide is sourced from PubChem (CID 8758218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).