C26H26BrCl2N3O5 — CID 87582387
ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]non-1-en-1-yl)amino]-3-[4-[(3,5-dichloro-1-oxidopyridin-1-ium-4-carbonyl)amino]phenyl]propanoate (PubChem CID 87582387) has the molecular formula C26H26BrCl2N3O5 and a molecular weight of 611.32 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]non-1-en-1-yl)amino]-3-[4-[(3,5-dichloro-1-oxidopyridin-1-ium-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]non-1-en-1-yl)amino]-3-[4-[(3,5-dichloro-1-oxidopyridin-1-ium-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 87582387 |
| Molecular Formula | C26H26BrCl2N3O5 |
| Molecular Weight | 611.32 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]non-1-en-1-yl)amino]-3-[4-[(3,5-dichloro-1-oxidopyridin-1-ium-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)c[n+]([O-])cc2Cl)cc1)NC1=C(Br)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C26H26BrCl2N3O5/c1-2-37-25(35)19(31-22-21(27)23(33)26(22)10-4-3-5-11-26)12-15-6-8-16(9-7-15)30-24(34)20-17(28)13-32(36)14-18(20)29/h6-9,13-14,19,31H,2-5,10-12H2,1H3,(H,30,34)/t19-/m0/s1 |
| InChIKey | COXIYMWGDUJYDG-IBGZPJMESA-N |
| XLogP | 5.08 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|