C27H37F3N2O4Si — CID 87582446
[(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[methyl-(2,2,2-trifluoroacetyl)amino]butyl]-propan-2-ylcarbamic acid (PubChem CID 87582446) has the molecular formula C27H37F3N2O4Si and a molecular weight of 538.68 g/mol. Its IUPAC name is [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[methyl-(2,2,2-trifluoroacetyl)amino]butyl]-propan-2-ylcarbamic acid.
| Compound Name | [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[methyl-(2,2,2-trifluoroacetyl)amino]butyl]-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 87582446 |
| Molecular Formula | C27H37F3N2O4Si |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | [(3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-[methyl-(2,2,2-trifluoroacetyl)amino]butyl]-propan-2-ylcarbamic acid |
| SMILES | CC(C)N(CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C)C(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C27H37F3N2O4Si/c1-20(2)32(25(34)35)18-17-21(31(6)24(33)27(28,29)30)19-36-37(26(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21H,17-19H2,1-6H3,(H,34,35)/t21-/m0/s1 |
| InChIKey | WQSRKNWFEZGYGJ-NRFANRHFSA-N |
| XLogP | 4.73 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|