C8F12Pt — CID 87582607
(1Z,5Z)-1,2,3,3,4,4,5,6,7,7,8,8-dodecafluorocycloocta-1,5-diene;platinum (PubChem CID 87582607) has the molecular formula C8F12Pt and a molecular weight of 519.14 g/mol. Its IUPAC name is (1Z,5Z)-1,2,3,3,4,4,5,6,7,7,8,8-dodecafluorocycloocta-1,5-diene;platinum.
| Compound Name | (1Z,5Z)-1,2,3,3,4,4,5,6,7,7,8,8-dodecafluorocycloocta-1,5-diene;platinum |
|---|---|
| PubChem CID | 87582607 |
| Molecular Formula | C8F12Pt |
| Molecular Weight | 519.14 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | (1Z,5Z)-1,2,3,3,4,4,5,6,7,7,8,8-dodecafluorocycloocta-1,5-diene;platinum |
| SMILES | F/C1=C(\F)C(F)(F)C(F)(F)/C(F)=C(/F)C(F)(F)C1(F)F.[Pt] |
| InChI | InChI=1S/C8F12.Pt/c9-1-2(10)6(15,16)8(19,20)4(12)3(11)7(17,18)5(1,13)14;/b2-1-,4-3-; |
| InChIKey | IKZDCVYPUXVULC-MEOHMOSHSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|