C14H27N3O2 — CID 87582665
N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]formamide (PubChem CID 87582665) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]formamide.
| Compound Name | N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]formamide |
|---|---|
| PubChem CID | 87582665 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-[3-[formyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]formamide |
| SMILES | CC1(C)CC(N(C=O)CCCNC=O)CC(C)(C)N1 |
| InChI | InChI=1S/C14H27N3O2/c1-13(2)8-12(9-14(3,4)16-13)17(11-19)7-5-6-15-10-18/h10-12,16H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | UPMMTESSCHHVTR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|