About diethyl carbonate;propan-2-ol
diethyl carbonate;propan-2-ol (PubChem CID 87583574) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is diethyl carbonate;propan-2-ol.
Molecular Properties
| Compound Name | diethyl carbonate;propan-2-ol |
| PubChem CID | 87583574 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | diethyl carbonate;propan-2-ol |
| SMILES | CC(C)O.CCOC(=O)OCC |
| InChI | InChI=1S/C5H10O3.C3H8O/c1-3-7-5(6)8-4-2;1-3(2)4/h3-4H2,1-2H3;3-4H,1-2H3 |
| InChIKey | MQTOBCLBYUBCSN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diethyl carbonate;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl carbonate;propan-2-ol?
The IUPAC name of diethyl carbonate;propan-2-ol (CID 87583574) is diethyl carbonate;propan-2-ol.
What is the SMILES notation for diethyl carbonate;propan-2-ol?
The canonical SMILES for diethyl carbonate;propan-2-ol is CC(C)O.CCOC(=O)OCC.
What is the InChIKey of diethyl carbonate;propan-2-ol?
The InChIKey is MQTOBCLBYUBCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C3H8O/c1-3-7-5(6)8-4-2;1-3(2)4/h3-4H2,1-2H3;3-4H,1-2H3.
What are the key properties of diethyl carbonate;propan-2-ol?
diethyl carbonate;propan-2-ol has a molecular weight of 178.23 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl carbonate;propan-2-ol is sourced from PubChem (CID 87583574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).