C22H20N2O4 — CID 87583608
tert-butyl 2-(6-formyl-3-oxo-1,2-dihydroisoindol-4-yl)indole-1-carboxylate (PubChem CID 87583608) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is tert-butyl 2-(6-formyl-3-oxo-1,2-dihydroisoindol-4-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(6-formyl-3-oxo-1,2-dihydroisoindol-4-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 87583608 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | tert-butyl 2-(6-formyl-3-oxo-1,2-dihydroisoindol-4-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2cc(C=O)cc3c2C(=O)NC3)cc2ccccc21 |
| InChI | InChI=1S/C22H20N2O4/c1-22(2,3)28-21(27)24-17-7-5-4-6-14(17)10-18(24)16-9-13(12-25)8-15-11-23-20(26)19(15)16/h4-10,12H,11H2,1-3H3,(H,23,26) |
| InChIKey | LDMDLLZKJBRTFM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|