About 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane
1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane (PubChem CID 87583743) has the molecular formula C26H34O2
and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane |
| PubChem CID | 87583743 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane |
| SMILES | C#CCOC12CC3CC(OCC#C)(C1)CC(C14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C26H34O2/c1-3-5-27-25-14-22-13-24(16-25,17-26(15-22,18-25)28-6-4-2)23-10-19-7-20(11-23)9-21(8-19)12-23/h1-2,19-22H,5-18H2 |
| InChIKey | CYAUQMBKTCCXAC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane?
The IUPAC name of 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane (CID 87583743) is 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane.
What is the SMILES notation for 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane?
The canonical SMILES for 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane is C#CCOC12CC3CC(OCC#C)(C1)CC(C14CC5CC(CC(C5)C1)C4)(C3)C2.
What is the InChIKey of 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane?
The InChIKey is CYAUQMBKTCCXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34O2/c1-3-5-27-25-14-22-13-24(16-25,17-26(15-22,18-25)28-6-4-2)23-10-19-7-20(11-23)9-21(8-19)12-23/h1-2,19-22H,5-18H2.
What are the key properties of 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane?
1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane has a molecular weight of 378.56 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3,5-bis(prop-2-ynoxy)adamantane is sourced from PubChem (CID 87583743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).