C38H42O6 — CID 87583822
1,3,5-tris(prop-2-ynoxy)-7-[3,5,7-tris(prop-2-ynoxy)-1-adamantyl]adamantane (PubChem CID 87583822) has the molecular formula C38H42O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is 1,3,5-tris(prop-2-ynoxy)-7-[3,5,7-tris(prop-2-ynoxy)-1-adamantyl]adamantane.
| Compound Name | 1,3,5-tris(prop-2-ynoxy)-7-[3,5,7-tris(prop-2-ynoxy)-1-adamantyl]adamantane |
|---|---|
| PubChem CID | 87583822 |
| Molecular Formula | C38H42O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 1,3,5-tris(prop-2-ynoxy)-7-[3,5,7-tris(prop-2-ynoxy)-1-adamantyl]adamantane |
| SMILES | C#CCOC12CC3(OCC#C)CC(OCC#C)(C1)CC(C14CC5(OCC#C)CC(OCC#C)(CC(OCC#C)(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C38H42O6/c1-7-13-39-33-19-31(20-34(25-33,40-14-8-2)27-35(21-31,26-33)41-15-9-3)32-22-36(42-16-10-4)28-37(23-32,43-17-11-5)30-38(24-32,29-36)44-18-12-6/h1-6H,13-30H2 |
| InChIKey | NDBPMRSXPVOVSG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|