C50H50O10 — CID 87583996
4-[3-(2,4-dihydroxyphenyl)-5-[3,5,7-tris(2,4-dihydroxyphenyl)-1-adamantyl]-1-adamantyl]benzene-1,3-diol (PubChem CID 87583996) has the molecular formula C50H50O10 and a molecular weight of 810.94 g/mol. Its IUPAC name is 4-[3-(2,4-dihydroxyphenyl)-5-[3,5,7-tris(2,4-dihydroxyphenyl)-1-adamantyl]-1-adamantyl]benzene-1,3-diol.
| Compound Name | 4-[3-(2,4-dihydroxyphenyl)-5-[3,5,7-tris(2,4-dihydroxyphenyl)-1-adamantyl]-1-adamantyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 87583996 |
| Molecular Formula | C50H50O10 |
| Molecular Weight | 810.94 g/mol |
| Exact Mass | 810.34 |
| IUPAC Name | 4-[3-(2,4-dihydroxyphenyl)-5-[3,5,7-tris(2,4-dihydroxyphenyl)-1-adamantyl]-1-adamantyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C23CC4CC(c5ccc(O)cc5O)(C2)CC(C25CC6(c7ccc(O)cc7O)CC(c7ccc(O)cc7O)(CC(c7ccc(O)cc7O)(C6)C2)C5)(C4)C3)c(O)c1 |
| InChI | InChI=1S/C50H50O10/c51-29-1-6-34(39(56)11-29)44-16-28-17-45(19-44,35-7-2-30(52)12-40(35)57)24-49(18-28,23-44)50-25-46(36-8-3-31(53)13-41(36)58)20-47(26-50,37-9-4-32(54)14-42(37)59)22-48(21-46,27-50)38-10-5-33(55)15-43(38)60/h1-15,28,51-60H,16-27H2 |
| InChIKey | KIVVXCIFXUPLAV-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.94 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |