About (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide
(Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide (PubChem CID 87584140) has the molecular formula C22H43NO4
and a molecular weight of 385.59 g/mol. Its IUPAC name is (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide.
Molecular Properties
| Compound Name | (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide |
| PubChem CID | 87584140 |
| Molecular Formula | C22H43NO4 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(CO)(CO)C(=O)N(C)CO |
| InChI | InChI=1S/C22H43NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(18-24,19-25)21(27)23(2)20-26/h10-11,24-26H,3-9,12-20H2,1-2H3/b11-10- |
| InChIKey | HUJIQBJPFBQMOB-KHPPLWFESA-N |
| XLogP | 4.01 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide?
The IUPAC name of (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide (CID 87584140) is (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide.
What is the SMILES notation for (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide?
The canonical SMILES for (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide is CCCCCCCC/C=C\CCCCCCC(CO)(CO)C(=O)N(C)CO.
What is the InChIKey of (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide?
The InChIKey is HUJIQBJPFBQMOB-KHPPLWFESA-N. The full InChI is InChI=1S/C22H43NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(18-24,19-25)21(27)23(2)20-26/h10-11,24-26H,3-9,12-20H2,1-2H3/b11-10-.
What are the key properties of (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide?
(Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide has a molecular weight of 385.59 g/mol, XLogP of 4.01, 18 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2,2-tris(hydroxymethyl)-N-methyloctadec-9-enamide is sourced from PubChem (CID 87584140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).