About tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate
tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate (PubChem CID 87584168) has the molecular formula C30H38O6
and a molecular weight of 494.63 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate |
| PubChem CID | 87584168 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)COc1ccc(C=CC=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H24O4.C8H14O2/c1-22(2,3)26-21(24)16-25-20-14-10-18(11-15-20)7-5-4-6-17-8-12-19(23)13-9-17;1-6(2)7(9)10-8(3,4)5/h4-15,23H,16H2,1-3H3;1H2,2-5H3 |
| InChIKey | QSVHUXIBRCORMW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate?
The IUPAC name of tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate (CID 87584168) is tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate.
What is the SMILES notation for tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate?
The canonical SMILES for tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)COc1ccc(C=CC=Cc2ccc(O)cc2)cc1.
What is the InChIKey of tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate?
The InChIKey is QSVHUXIBRCORMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O4.C8H14O2/c1-22(2,3)26-21(24)16-25-20-14-10-18(11-15-20)7-5-4-6-17-8-12-19(23)13-9-17;1-6(2)7(9)10-8(3,4)5/h4-15,23H,16H2,1-3H3;1H2,2-5H3.
What are the key properties of tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate?
tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate has a molecular weight of 494.63 g/mol, XLogP of 6.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenoxy]acetate;tert-butyl 2-methylprop-2-enoate is sourced from PubChem (CID 87584168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).