About 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile
4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile (PubChem CID 87584205) has the molecular formula C23H21NO5
and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile |
| PubChem CID | 87584205 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile |
| SMILES | CCCOc1cc2cc(C(=O)c3ccc(C#N)cc3)c(=O)oc2cc1OCCC |
| InChI | InChI=1S/C23H21NO5/c1-3-9-27-20-12-17-11-18(22(25)16-7-5-15(14-24)6-8-16)23(26)29-19(17)13-21(20)28-10-4-2/h5-8,11-13H,3-4,9-10H2,1-2H3 |
| InChIKey | AUALRNGGKKMWCJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile?
The IUPAC name of 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile (CID 87584205) is 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile.
What is the SMILES notation for 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile?
The canonical SMILES for 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile is CCCOc1cc2cc(C(=O)c3ccc(C#N)cc3)c(=O)oc2cc1OCCC.
What is the InChIKey of 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile?
The InChIKey is AUALRNGGKKMWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO5/c1-3-9-27-20-12-17-11-18(22(25)16-7-5-15(14-24)6-8-16)23(26)29-19(17)13-21(20)28-10-4-2/h5-8,11-13H,3-4,9-10H2,1-2H3.
What are the key properties of 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile?
4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile has a molecular weight of 391.42 g/mol, XLogP of 4.47, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-6,7-dipropoxychromene-3-carbonyl)benzonitrile is sourced from PubChem (CID 87584205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).