About 3-dimethylarsanyl-N,N,2-trimethylbenzamide
3-dimethylarsanyl-N,N,2-trimethylbenzamide (PubChem CID 87584443) has the molecular formula C12H18AsNO
and a molecular weight of 267.20 g/mol. Its IUPAC name is 3-dimethylarsanyl-N,N,2-trimethylbenzamide.
Molecular Properties
| Compound Name | 3-dimethylarsanyl-N,N,2-trimethylbenzamide |
| PubChem CID | 87584443 |
| Molecular Formula | C12H18AsNO |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-dimethylarsanyl-N,N,2-trimethylbenzamide |
| SMILES | Cc1c(C(=O)N(C)C)cccc1[As](C)C |
| InChI | InChI=1S/C12H18AsNO/c1-9-10(12(15)14(4)5)7-6-8-11(9)13(2)3/h6-8H,1-5H3 |
| InChIKey | HDEMYEQQAVAWBN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethylarsanyl-N,N,2-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylarsanyl-N,N,2-trimethylbenzamide?
The IUPAC name of 3-dimethylarsanyl-N,N,2-trimethylbenzamide (CID 87584443) is 3-dimethylarsanyl-N,N,2-trimethylbenzamide.
What is the SMILES notation for 3-dimethylarsanyl-N,N,2-trimethylbenzamide?
The canonical SMILES for 3-dimethylarsanyl-N,N,2-trimethylbenzamide is Cc1c(C(=O)N(C)C)cccc1[As](C)C.
What is the InChIKey of 3-dimethylarsanyl-N,N,2-trimethylbenzamide?
The InChIKey is HDEMYEQQAVAWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18AsNO/c1-9-10(12(15)14(4)5)7-6-8-11(9)13(2)3/h6-8H,1-5H3.
What are the key properties of 3-dimethylarsanyl-N,N,2-trimethylbenzamide?
3-dimethylarsanyl-N,N,2-trimethylbenzamide has a molecular weight of 267.20 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylarsanyl-N,N,2-trimethylbenzamide is sourced from PubChem (CID 87584443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).