About CID 87584548
CID 87584548 (PubChem CID 87584548) has the molecular formula C6H5N3Pb
and a molecular weight of 326.33 g/mol.
Molecular Properties
| Compound Name | CID 87584548 |
| PubChem CID | 87584548 |
| Molecular Formula | C6H5N3Pb |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | — |
| SMILES | [Pb].c1ncc2cc[nH]c2n1 |
| InChI | InChI=1S/C6H5N3.Pb/c1-2-8-6-5(1)3-7-4-9-6;/h1-4H,(H,7,8,9); |
| InChIKey | ZJWULYBFKHRLAJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 87584548 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87584548?
The IUPAC name of CID 87584548 (CID 87584548) is not available.
What is the SMILES notation for CID 87584548?
The canonical SMILES for CID 87584548 is [Pb].c1ncc2cc[nH]c2n1.
What is the InChIKey of CID 87584548?
The InChIKey is ZJWULYBFKHRLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.Pb/c1-2-8-6-5(1)3-7-4-9-6;/h1-4H,(H,7,8,9);.
What are the key properties of CID 87584548?
CID 87584548 has a molecular weight of 326.33 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87584548 is sourced from PubChem (CID 87584548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).