C17H22N3O2+ — CID 87584773
2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-morpholin-4-ylphenyl)ethanone (PubChem CID 87584773) has the molecular formula C17H22N3O2+ and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-morpholin-4-ylphenyl)ethanone.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-morpholin-4-ylphenyl)ethanone |
|---|---|
| PubChem CID | 87584773 |
| Molecular Formula | C17H22N3O2+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-morpholin-4-ylphenyl)ethanone |
| SMILES | Cc1n(CC(=O)c2ccc(N3CCOCC3)cc2)cc[n+]1C |
| InChI | InChI=1S/C17H22N3O2/c1-14-18(2)7-8-20(14)13-17(21)15-3-5-16(6-4-15)19-9-11-22-12-10-19/h3-8H,9-13H2,1-2H3/q+1 |
| InChIKey | GBGAVDBKQSEZKW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|