C32H34F7N5O6 — CID 87585158
4-[5-ethoxy-N-[(6-ethyl-1H-benzimidazol-2-yl)methyl]-2-fluoro-3-propan-2-yloxyanilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87585158) has the molecular formula C32H34F7N5O6 and a molecular weight of 717.64 g/mol. Its IUPAC name is 4-[5-ethoxy-N-[(6-ethyl-1H-benzimidazol-2-yl)methyl]-2-fluoro-3-propan-2-yloxyanilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[5-ethoxy-N-[(6-ethyl-1H-benzimidazol-2-yl)methyl]-2-fluoro-3-propan-2-yloxyanilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87585158 |
| Molecular Formula | C32H34F7N5O6 |
| Molecular Weight | 717.64 g/mol |
| Exact Mass | 717.24 |
| IUPAC Name | 4-[5-ethoxy-N-[(6-ethyl-1H-benzimidazol-2-yl)methyl]-2-fluoro-3-propan-2-yloxyanilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N(Cc2nc3ccc(CC)cc3[nH]2)c2cc(OCC)cc(OC(C)C)c2F)cc1 |
| InChI | InChI=1S/C28H32FN5O2.2C2HF3O2/c1-5-18-7-12-22-23(13-18)33-26(32-22)16-34(20-10-8-19(9-11-20)28(30)31)24-14-21(35-6-2)15-25(27(24)29)36-17(3)4;2*3-2(4,5)1(6)7/h7-15,17H,5-6,16H2,1-4H3,(H3,30,31)(H,32,33);2*(H,6,7) |
| InChIKey | XMZFEKHOMKGWBN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 174.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|