C27H27F3N6O3 — CID 87585162
4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-N'-hydroxybenzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 87585162) has the molecular formula C27H27F3N6O3 and a molecular weight of 540.55 g/mol. Its IUPAC name is 4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-N'-hydroxybenzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-N'-hydroxybenzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87585162 |
| Molecular Formula | C27H27F3N6O3 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-N'-hydroxybenzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cccc(C(Nc2ccc(/C(N)=N/O)cc2)c2nc(-c3ccccc3)nn2C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N6O.C2HF3O2/c1-3-17-8-7-11-20(16-17)22(27-21-14-12-18(13-15-21)23(26)30-32)25-28-24(29-31(25)2)19-9-5-4-6-10-19;3-2(4,5)1(6)7/h4-16,22,27,32H,3H2,1-2H3,(H2,26,30);(H,6,7) |
| InChIKey | GVVQVHAXIYCWBP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|