About 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide
4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide (PubChem CID 87585240) has the molecular formula C21H27F6N3O
and a molecular weight of 451.46 g/mol. Its IUPAC name is 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide |
| PubChem CID | 87585240 |
| Molecular Formula | C21H27F6N3O |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(CCN2CCN(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H27F6N3O/c22-20(23,24)16-11-17(21(25,26)27)13-18(12-16)30-9-7-29(8-10-30)6-5-14-1-3-15(4-2-14)19(28)31/h11-15H,1-10H2,(H2,28,31) |
| InChIKey | DZCMAZKCFGFTQO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide?
The IUPAC name of 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide (CID 87585240) is 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide?
The canonical SMILES for 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide is NC(=O)C1CCC(CCN2CCN(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)CC1.
What is the InChIKey of 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide?
The InChIKey is DZCMAZKCFGFTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F6N3O/c22-20(23,24)16-11-17(21(25,26)27)13-18(12-16)30-9-7-29(8-10-30)6-5-14-1-3-15(4-2-14)19(28)31/h11-15H,1-10H2,(H2,28,31).
What are the key properties of 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide?
4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide has a molecular weight of 451.46 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 87585240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).