About N,N-diethylethanamine;2-(ethylamino)ethanol
N,N-diethylethanamine;2-(ethylamino)ethanol (PubChem CID 87585647) has the molecular formula C10H26N2O
and a molecular weight of 190.33 g/mol. Its IUPAC name is N,N-diethylethanamine;2-(ethylamino)ethanol.
Molecular Properties
| Compound Name | N,N-diethylethanamine;2-(ethylamino)ethanol |
| PubChem CID | 87585647 |
| Molecular Formula | C10H26N2O |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.20 |
| IUPAC Name | N,N-diethylethanamine;2-(ethylamino)ethanol |
| SMILES | CCN(CC)CC.CCNCCO |
| InChI | InChI=1S/C6H15N.C4H11NO/c1-4-7(5-2)6-3;1-2-5-3-4-6/h4-6H2,1-3H3;5-6H,2-4H2,1H3 |
| InChIKey | CLCLUGSJNXAIPP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;2-(ethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;2-(ethylamino)ethanol?
The IUPAC name of N,N-diethylethanamine;2-(ethylamino)ethanol (CID 87585647) is N,N-diethylethanamine;2-(ethylamino)ethanol.
What is the SMILES notation for N,N-diethylethanamine;2-(ethylamino)ethanol?
The canonical SMILES for N,N-diethylethanamine;2-(ethylamino)ethanol is CCN(CC)CC.CCNCCO.
What is the InChIKey of N,N-diethylethanamine;2-(ethylamino)ethanol?
The InChIKey is CLCLUGSJNXAIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H11NO/c1-4-7(5-2)6-3;1-2-5-3-4-6/h4-6H2,1-3H3;5-6H,2-4H2,1H3.
What are the key properties of N,N-diethylethanamine;2-(ethylamino)ethanol?
N,N-diethylethanamine;2-(ethylamino)ethanol has a molecular weight of 190.33 g/mol, XLogP of 0.94, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;2-(ethylamino)ethanol is sourced from PubChem (CID 87585647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).