About 6-(butoxymethyl)-3H-1,2-benzodioxole
6-(butoxymethyl)-3H-1,2-benzodioxole (PubChem CID 87586218) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(butoxymethyl)-3H-1,2-benzodioxole.
Molecular Properties
| Compound Name | 6-(butoxymethyl)-3H-1,2-benzodioxole |
| PubChem CID | 87586218 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 6-(butoxymethyl)-3H-1,2-benzodioxole |
| SMILES | CCCCOCc1ccc2c(c1)OOC2 |
| InChI | InChI=1S/C12H16O3/c1-2-3-6-13-8-10-4-5-11-9-14-15-12(11)7-10/h4-5,7H,2-3,6,8-9H2,1H3 |
| InChIKey | PEKICGQGAHJOEX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-(butoxymethyl)-3H-1,2-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(butoxymethyl)-3H-1,2-benzodioxole?
The IUPAC name of 6-(butoxymethyl)-3H-1,2-benzodioxole (CID 87586218) is 6-(butoxymethyl)-3H-1,2-benzodioxole.
What is the SMILES notation for 6-(butoxymethyl)-3H-1,2-benzodioxole?
The canonical SMILES for 6-(butoxymethyl)-3H-1,2-benzodioxole is CCCCOCc1ccc2c(c1)OOC2.
What is the InChIKey of 6-(butoxymethyl)-3H-1,2-benzodioxole?
The InChIKey is PEKICGQGAHJOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-3-6-13-8-10-4-5-11-9-14-15-12(11)7-10/h4-5,7H,2-3,6,8-9H2,1H3.
What are the key properties of 6-(butoxymethyl)-3H-1,2-benzodioxole?
6-(butoxymethyl)-3H-1,2-benzodioxole has a molecular weight of 208.26 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(butoxymethyl)-3H-1,2-benzodioxole is sourced from PubChem (CID 87586218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).