C49H31F9N2O7 — CID 87586281
2-[1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid;2-[1-benzyl-7-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 87586281) has the molecular formula C49H31F9N2O7 and a molecular weight of 930.78 g/mol. Its IUPAC name is 2-[1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid;2-[1-benzyl-7-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid;2-[1-benzyl-7-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 87586281 |
| Molecular Formula | C49H31F9N2O7 |
| Molecular Weight | 930.78 g/mol |
| Exact Mass | 930.20 |
| IUPAC Name | 2-[1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid;2-[1-benzyl-7-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cn(Cc2ccccc2)c2c(-c3ccc(OC(F)(F)F)cc3)cccc12.O=C(O)C(=O)c1cn(Cc2ccccc2)c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C25H15F6NO3.C24H16F3NO4/c26-24(27,28)17-8-16(9-18(11-17)25(29,30)31)15-6-7-21-19(10-15)20(22(33)23(34)35)13-32(21)12-14-4-2-1-3-5-14;25-24(26,27)32-17-11-9-16(10-12-17)18-7-4-8-19-20(22(29)23(30)31)14-28(21(18)19)13-15-5-2-1-3-6-15/h1-11,13H,12H2,(H,34,35);1-12,14H,13H2,(H,30,31) |
| InChIKey | KJQVFIHVHHKXOK-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.78 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|