C17H20N4O8S — CID 87586424
[3-(1,4-diazabicyclo[3.2.1]octane-4-carbonyl)-1H-indazol-5-yl] methanesulfonate;oxalic acid (PubChem CID 87586424) has the molecular formula C17H20N4O8S and a molecular weight of 440.43 g/mol. Its IUPAC name is [3-(1,4-diazabicyclo[3.2.1]octane-4-carbonyl)-1H-indazol-5-yl] methanesulfonate;oxalic acid.
| Compound Name | [3-(1,4-diazabicyclo[3.2.1]octane-4-carbonyl)-1H-indazol-5-yl] methanesulfonate;oxalic acid |
|---|---|
| PubChem CID | 87586424 |
| Molecular Formula | C17H20N4O8S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [3-(1,4-diazabicyclo[3.2.1]octane-4-carbonyl)-1H-indazol-5-yl] methanesulfonate;oxalic acid |
| SMILES | CS(=O)(=O)Oc1ccc2[nH]nc(C(=O)N3CCN4CCC3C4)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H18N4O4S.C2H2O4/c1-24(21,22)23-11-2-3-13-12(8-11)14(17-16-13)15(20)19-7-6-18-5-4-10(19)9-18;3-1(4)2(5)6/h2-3,8,10H,4-7,9H2,1H3,(H,16,17);(H,3,4)(H,5,6) |
| InChIKey | CRAYWZNVKDZTCH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 170.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|