C22H28N6O5S2 — CID 87586692
2-[6-[[4-(diethylamino)phenyl]diazenyl]-7-methylpyrazolo[3,4-f][1,3]benzothiazol-7-ium-1-yl]ethanol;methyl sulfate (PubChem CID 87586692) has the molecular formula C22H28N6O5S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 2-[6-[[4-(diethylamino)phenyl]diazenyl]-7-methylpyrazolo[3,4-f][1,3]benzothiazol-7-ium-1-yl]ethanol;methyl sulfate.
| Compound Name | 2-[6-[[4-(diethylamino)phenyl]diazenyl]-7-methylpyrazolo[3,4-f][1,3]benzothiazol-7-ium-1-yl]ethanol;methyl sulfate |
|---|---|
| PubChem CID | 87586692 |
| Molecular Formula | C22H28N6O5S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[6-[[4-(diethylamino)phenyl]diazenyl]-7-methylpyrazolo[3,4-f][1,3]benzothiazol-7-ium-1-yl]ethanol;methyl sulfate |
| SMILES | CCN(CC)c1ccc(/N=N/c2sc3cc4cnn(CCO)c4cc3[n+]2C)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H25N6OS.CH4O4S/c1-4-26(5-2)17-8-6-16(7-9-17)23-24-21-25(3)19-13-18-15(12-20(19)29-21)14-22-27(18)10-11-28;1-5-6(2,3)4/h6-9,12-14,28H,4-5,10-11H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | AVGYLJDYFKURFS-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|