C20H29NTi — CID 87586739
tert-butylazanide;1-ethyl-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)benzene;titanium(2+) (PubChem CID 87586739) has the molecular formula C20H29NTi and a molecular weight of 331.33 g/mol. Its IUPAC name is tert-butylazanide;1-ethyl-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)benzene;titanium(2+).
| Compound Name | tert-butylazanide;1-ethyl-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)benzene;titanium(2+) |
|---|---|
| PubChem CID | 87586739 |
| Molecular Formula | C20H29NTi |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butylazanide;1-ethyl-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)benzene;titanium(2+) |
| SMILES | CC(C)(C)[NH-].C[CH-]c1ccccc1C1=C(C)C(C)=C(C)C1.[Ti+2] |
| InChI | InChI=1S/C16H19.C4H10N.Ti/c1-5-14-8-6-7-9-15(14)16-10-11(2)12(3)13(16)4;1-4(2,3)5;/h5-9H,10H2,1-4H3;5H,1-3H3;/q2*-1;+2 |
| InChIKey | CBJUAISFTIRZFZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|