C22H18F8N2O — CID 87587208
(E)-N-[1-[3,5-bis(trifluoromethyl)phenyl]piperidin-4-yl]-3-(3,5-difluorophenyl)prop-2-enamide (PubChem CID 87587208) has the molecular formula C22H18F8N2O and a molecular weight of 478.38 g/mol. Its IUPAC name is (E)-N-[1-[3,5-bis(trifluoromethyl)phenyl]piperidin-4-yl]-3-(3,5-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[3,5-bis(trifluoromethyl)phenyl]piperidin-4-yl]-3-(3,5-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 87587208 |
| Molecular Formula | C22H18F8N2O |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (E)-N-[1-[3,5-bis(trifluoromethyl)phenyl]piperidin-4-yl]-3-(3,5-difluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)NC1CCN(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H18F8N2O/c23-16-7-13(8-17(24)12-16)1-2-20(33)31-18-3-5-32(6-4-18)19-10-14(21(25,26)27)9-15(11-19)22(28,29)30/h1-2,7-12,18H,3-6H2,(H,31,33)/b2-1+ |
| InChIKey | BOSXABMCWRTXRT-OWOJBTEDSA-N |
| XLogP | 5.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|