C38H50N4O8S2 — CID 87587278
1-N,2-N-dimethyl-1-N,2-N-bis[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]hexane-1,2-diamine;methyl sulfate (PubChem CID 87587278) has the molecular formula C38H50N4O8S2 and a molecular weight of 754.97 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-1-N,2-N-bis[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]hexane-1,2-diamine;methyl sulfate.
| Compound Name | 1-N,2-N-dimethyl-1-N,2-N-bis[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]hexane-1,2-diamine;methyl sulfate |
|---|---|
| PubChem CID | 87587278 |
| Molecular Formula | C38H50N4O8S2 |
| Molecular Weight | 754.97 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | 1-N,2-N-dimethyl-1-N,2-N-bis[4-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenyl]hexane-1,2-diamine;methyl sulfate |
| SMILES | CCCCC(CN(C)c1ccc(/C=C/c2cccc[n+]2C)cc1)N(C)c1ccc(/C=C/c2cccc[n+]2C)cc1.COS(=O)(=O)[O-].COS(=O)(=O)[O-] |
| InChI | InChI=1S/C36H44N4.2CH4O4S/c1-6-7-12-36(40(5)35-25-19-31(20-26-35)16-22-33-14-9-11-28-38(33)3)29-39(4)34-23-17-30(18-24-34)15-21-32-13-8-10-27-37(32)2;2*1-5-6(2,3)4/h8-11,13-28,36H,6-7,12,29H2,1-5H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
| InChIKey | WNHRMIILVWEKNY-UHFFFAOYSA-L |
| XLogP | 4.99 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|