C6H12N4O8 — CID 87587383
5,6-dinitro-1,2,3,4-tetraoxa-5,6-diazacyclododecane (PubChem CID 87587383) has the molecular formula C6H12N4O8 and a molecular weight of 268.18 g/mol. Its IUPAC name is 5,6-dinitro-1,2,3,4-tetraoxa-5,6-diazacyclododecane.
| Compound Name | 5,6-dinitro-1,2,3,4-tetraoxa-5,6-diazacyclododecane |
|---|---|
| PubChem CID | 87587383 |
| Molecular Formula | C6H12N4O8 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5,6-dinitro-1,2,3,4-tetraoxa-5,6-diazacyclododecane |
| SMILES | O=[N+]([O-])N1CCCCCCOOOON1[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N4O8/c11-9(12)7-5-3-1-2-4-6-15-17-18-16-8(7)10(13)14/h1-6H2 |
| InChIKey | OXQTUPSPLCJLOY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 129.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|