About CID 87587512
CID 87587512 (PubChem CID 87587512) has the molecular formula C18H35OSi
and a molecular weight of 295.56 g/mol.
Molecular Properties
| Compound Name | CID 87587512 |
| PubChem CID | 87587512 |
| Molecular Formula | C18H35OSi |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | — |
| SMILES | CCCC/C1=C(\O[Si](C)C)CCCCCCCCCC1 |
| InChI | InChI=1S/C18H35OSi/c1-4-5-14-17-15-12-10-8-6-7-9-11-13-16-18(17)19-20(2)3/h4-16H2,1-3H3/b18-17+ |
| InChIKey | LSANQTWJJPECEO-ISLYRVAYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87587512 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87587512?
The IUPAC name of CID 87587512 (CID 87587512) is not available.
What is the SMILES notation for CID 87587512?
The canonical SMILES for CID 87587512 is CCCC/C1=C(\O[Si](C)C)CCCCCCCCCC1.
What is the InChIKey of CID 87587512?
The InChIKey is LSANQTWJJPECEO-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H35OSi/c1-4-5-14-17-15-12-10-8-6-7-9-11-13-16-18(17)19-20(2)3/h4-16H2,1-3H3/b18-17+.
What are the key properties of CID 87587512?
CID 87587512 has a molecular weight of 295.56 g/mol, XLogP of 6.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87587512 is sourced from PubChem (CID 87587512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).