About butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate
butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 87587903) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| PubChem CID | 87587903 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CCCCOC(=O)C1(C)CCC=[N+]1[O-] |
| InChI | InChI=1S/C10H17NO3/c1-3-4-8-14-9(12)10(2)6-5-7-11(10)13/h7H,3-6,8H2,1-2H3 |
| InChIKey | PWUQSJRCJJYOND-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The IUPAC name of butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (CID 87587903) is butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
What is the SMILES notation for butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The canonical SMILES for butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is CCCCOC(=O)C1(C)CCC=[N+]1[O-].
What is the InChIKey of butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The InChIKey is PWUQSJRCJJYOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-3-4-8-14-9(12)10(2)6-5-7-11(10)13/h7H,3-6,8H2,1-2H3.
What are the key properties of butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is sourced from PubChem (CID 87587903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).