About chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide
chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide (PubChem CID 87588027) has the molecular formula C11H23ClN2O
and a molecular weight of 234.77 g/mol. Its IUPAC name is chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide |
| PubChem CID | 87588027 |
| Molecular Formula | C11H23ClN2O |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCN(CC)CC.CCCl |
| InChI | InChI=1S/C9H18N2O.C2H5Cl/c1-4-9(12)10-7-8-11(5-2)6-3;1-2-3/h4H,1,5-8H2,2-3H3,(H,10,12);2H2,1H3 |
| InChIKey | OULMRFSMZVWKME-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide?
The IUPAC name of chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide (CID 87588027) is chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide.
What is the SMILES notation for chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide?
The canonical SMILES for chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide is C=CC(=O)NCCN(CC)CC.CCCl.
What is the InChIKey of chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide?
The InChIKey is OULMRFSMZVWKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C2H5Cl/c1-4-9(12)10-7-8-11(5-2)6-3;1-2-3/h4H,1,5-8H2,2-3H3,(H,10,12);2H2,1H3.
What are the key properties of chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide?
chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide has a molecular weight of 234.77 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;N-[2-(diethylamino)ethyl]prop-2-enamide is sourced from PubChem (CID 87588027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).