C25H28F4O4S2 — CID 87588450
[1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87588450) has the molecular formula C25H28F4O4S2 and a molecular weight of 532.62 g/mol. Its IUPAC name is [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87588450 |
| Molecular Formula | C25H28F4O4S2 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=C(CS1(OS(=O)(=O)C(F)(F)C(F)(F)C2CC3CCC2C3)CCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H28F4O4S2/c26-24(27,22-15-17-10-11-19(22)14-17)25(28,29)35(31,32)33-34(12-3-4-13-34)16-23(30)21-9-5-7-18-6-1-2-8-20(18)21/h1-2,5-9,17,19,22H,3-4,10-16H2 |
| InChIKey | WGHGXPSHCZRMEY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|