C17H19ClF3N7O4 — CID 87588535
2-(7-but-2-ynyl-2-chloro-8-oxo-6-piperazin-1-ylpurin-9-yl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 87588535) has the molecular formula C17H19ClF3N7O4 and a molecular weight of 477.83 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-2-chloro-8-oxo-6-piperazin-1-ylpurin-9-yl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(7-but-2-ynyl-2-chloro-8-oxo-6-piperazin-1-ylpurin-9-yl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87588535 |
| Molecular Formula | C17H19ClF3N7O4 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-(7-but-2-ynyl-2-chloro-8-oxo-6-piperazin-1-ylpurin-9-yl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(=O)n(CC(N)=O)c2nc(Cl)nc(N3CCNCC3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18ClN7O2.C2HF3O2/c1-2-3-6-22-11-12(21-7-4-18-5-8-21)19-14(16)20-13(11)23(15(22)25)9-10(17)24;3-2(4,5)1(6)7/h18H,4-9H2,1H3,(H2,17,24);(H,6,7) |
| InChIKey | LGYRKEFDKYOHST-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|