About diphenyliodanium;2,3,4-trifluorobenzenesulfonate
diphenyliodanium;2,3,4-trifluorobenzenesulfonate (PubChem CID 87588668) has the molecular formula C18H12F3IO3S
and a molecular weight of 492.26 g/mol. Its IUPAC name is diphenyliodanium;2,3,4-trifluorobenzenesulfonate.
Molecular Properties
| Compound Name | diphenyliodanium;2,3,4-trifluorobenzenesulfonate |
| PubChem CID | 87588668 |
| Molecular Formula | C18H12F3IO3S |
| Molecular Weight | 492.26 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | diphenyliodanium;2,3,4-trifluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(F)c(F)c1F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.C6H3F3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-10H;1-2H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | HGIDKYVXTZTQQB-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze diphenyliodanium;2,3,4-trifluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyliodanium;2,3,4-trifluorobenzenesulfonate?
The IUPAC name of diphenyliodanium;2,3,4-trifluorobenzenesulfonate (CID 87588668) is diphenyliodanium;2,3,4-trifluorobenzenesulfonate.
What is the SMILES notation for diphenyliodanium;2,3,4-trifluorobenzenesulfonate?
The canonical SMILES for diphenyliodanium;2,3,4-trifluorobenzenesulfonate is O=S(=O)([O-])c1ccc(F)c(F)c1F.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of diphenyliodanium;2,3,4-trifluorobenzenesulfonate?
The InChIKey is HGIDKYVXTZTQQB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10I.C6H3F3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-10H;1-2H,(H,10,11,12)/q+1;/p-1.
What are the key properties of diphenyliodanium;2,3,4-trifluorobenzenesulfonate?
diphenyliodanium;2,3,4-trifluorobenzenesulfonate has a molecular weight of 492.26 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyliodanium;2,3,4-trifluorobenzenesulfonate is sourced from PubChem (CID 87588668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).