C20H19ClF3N7O3 — CID 87588892
7-but-2-ynyl-9-(2-chloro-4-pyridinyl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid (PubChem CID 87588892) has the molecular formula C20H19ClF3N7O3 and a molecular weight of 497.87 g/mol. Its IUPAC name is 7-but-2-ynyl-9-(2-chloro-4-pyridinyl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-9-(2-chloro-4-pyridinyl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87588892 |
| Molecular Formula | C20H19ClF3N7O3 |
| Molecular Weight | 497.87 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 7-but-2-ynyl-9-(2-chloro-4-pyridinyl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(=O)n(-c2ccnc(Cl)c2)c2ncnc(N3CCNCC3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18ClN7O.C2HF3O2/c1-2-3-8-25-15-16(24-9-6-20-7-10-24)22-12-23-17(15)26(18(25)27)13-4-5-21-14(19)11-13;3-2(4,5)1(6)7/h4-5,11-12,20H,6-10H2,1H3;(H,6,7) |
| InChIKey | BEJVRXMONFLTMG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|