About 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole
4-methyl-5-phenyl-3,4-dihydro-2H-phosphole (PubChem CID 87590104) has the molecular formula C11H13P
and a molecular weight of 176.20 g/mol. Its IUPAC name is 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole.
Molecular Properties
| Compound Name | 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole |
| PubChem CID | 87590104 |
| Molecular Formula | C11H13P |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole |
| SMILES | CC1CCP=C1c1ccccc1 |
| InChI | InChI=1S/C11H13P/c1-9-7-8-12-11(9)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | GSQJJEWLBQTDEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole?
The IUPAC name of 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole (CID 87590104) is 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole.
What is the SMILES notation for 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole?
The canonical SMILES for 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole is CC1CCP=C1c1ccccc1.
What is the InChIKey of 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole?
The InChIKey is GSQJJEWLBQTDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13P/c1-9-7-8-12-11(9)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3.
What are the key properties of 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole?
4-methyl-5-phenyl-3,4-dihydro-2H-phosphole has a molecular weight of 176.20 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-phenyl-3,4-dihydro-2H-phosphole is sourced from PubChem (CID 87590104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).