C15H16N2O4S2 — CID 87590153
(E)-2-(1-benzyl-5-oxo-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethenesulfonic acid (PubChem CID 87590153) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (E)-2-(1-benzyl-5-oxo-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethenesulfonic acid.
| Compound Name | (E)-2-(1-benzyl-5-oxo-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethenesulfonic acid |
|---|---|
| PubChem CID | 87590153 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (E)-2-(1-benzyl-5-oxo-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl)ethenesulfonic acid |
| SMILES | O=S1CCc2c(c(/C=C/S(=O)(=O)O)nn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-22-8-6-15-13(11-22)14(7-9-23(19,20)21)16-17(15)10-12-4-2-1-3-5-12/h1-5,7,9H,6,8,10-11H2,(H,19,20,21)/b9-7+ |
| InChIKey | JNXGYNKJEFZEEH-VQHVLOKHSA-N |
| XLogP | 1.59 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|