About magnesium;ethanol;methanidylbenzene
magnesium;ethanol;methanidylbenzene (PubChem CID 87590211) has the molecular formula C9H12MgO
and a molecular weight of 160.50 g/mol. Its IUPAC name is magnesium;ethanol;methanidylbenzene.
Molecular Properties
| Compound Name | magnesium;ethanol;methanidylbenzene |
| PubChem CID | 87590211 |
| Molecular Formula | C9H12MgO |
| Molecular Weight | 160.50 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | magnesium;ethanol;methanidylbenzene |
| SMILES | [CH2-]CO.[CH2-]c1ccccc1.[Mg+2] |
| InChI | InChI=1S/C7H7.C2H5O.Mg/c1-7-5-3-2-4-6-7;1-2-3;/h2-6H,1H2;3H,1-2H2;/q2*-1;+2 |
| InChIKey | CZELHSFGVIDOBK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;ethanol;methanidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;ethanol;methanidylbenzene?
The IUPAC name of magnesium;ethanol;methanidylbenzene (CID 87590211) is magnesium;ethanol;methanidylbenzene.
What is the SMILES notation for magnesium;ethanol;methanidylbenzene?
The canonical SMILES for magnesium;ethanol;methanidylbenzene is [CH2-]CO.[CH2-]c1ccccc1.[Mg+2].
What is the InChIKey of magnesium;ethanol;methanidylbenzene?
The InChIKey is CZELHSFGVIDOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C2H5O.Mg/c1-7-5-3-2-4-6-7;1-2-3;/h2-6H,1H2;3H,1-2H2;/q2*-1;+2.
What are the key properties of magnesium;ethanol;methanidylbenzene?
magnesium;ethanol;methanidylbenzene has a molecular weight of 160.50 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;ethanol;methanidylbenzene is sourced from PubChem (CID 87590211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).