About CID 87590388
CID 87590388 (PubChem CID 87590388) has the molecular formula C12H28B2O4
and a molecular weight of 257.98 g/mol.
Molecular Properties
| Compound Name | CID 87590388 |
| PubChem CID | 87590388 |
| Molecular Formula | C12H28B2O4 |
| Molecular Weight | 257.98 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O.CC(C)(O)C(C)(C)O.[B][B] |
| InChI | InChI=1S/2C6H14O2.B2/c2*1-5(2,7)6(3,4)8;1-2/h2*7-8H,1-4H3; |
| InChIKey | ZNWYAABYXZLQRD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.98 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87590388 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87590388?
The IUPAC name of CID 87590388 (CID 87590388) is not available.
What is the SMILES notation for CID 87590388?
The canonical SMILES for CID 87590388 is CC(C)(O)C(C)(C)O.CC(C)(O)C(C)(C)O.[B][B].
What is the InChIKey of CID 87590388?
The InChIKey is ZNWYAABYXZLQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14O2.B2/c2*1-5(2,7)6(3,4)8;1-2/h2*7-8H,1-4H3;.
What are the key properties of CID 87590388?
CID 87590388 has a molecular weight of 257.98 g/mol, XLogP of 0.29, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87590388 is sourced from PubChem (CID 87590388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).