C25H40N4OS — CID 87590690
1-[(1R,2R)-2-(benzylamino)cyclohexyl]-3-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)thiourea (PubChem CID 87590690) has the molecular formula C25H40N4OS and a molecular weight of 444.69 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(benzylamino)cyclohexyl]-3-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)thiourea.
| Compound Name | 1-[(1R,2R)-2-(benzylamino)cyclohexyl]-3-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 87590690 |
| Molecular Formula | C25H40N4OS |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 1-[(1R,2R)-2-(benzylamino)cyclohexyl]-3-(3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl)thiourea |
| SMILES | CC(C)(C)C(NC(=S)N[C@@H]1CCCC[C@H]1NCc1ccccc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H40N4OS/c1-25(2,3)22(23(30)29-16-10-5-11-17-29)28-24(31)27-21-15-9-8-14-20(21)26-18-19-12-6-4-7-13-19/h4,6-7,12-13,20-22,26H,5,8-11,14-18H2,1-3H3,(H2,27,28,31)/t20-,21-,22?/m1/s1 |
| InChIKey | OWISJOAHVQMYPH-JAZPPYFYSA-N |
| XLogP | 3.98 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|